Predicate Functors

Functors that return bool are an important special case. A unary function whose return type is bool is called a predicate.

In OEChem TK, these functors are often passed into another function. The functors are then called from inside the second function. This is the concept of a callback, because the second function provides the argument and ‘call’s back’ to the functor which was passed into the function. Generator method such as OEMolBase.GetAtoms can take a functor as an argument and use the callback mechanism to iterate over atoms that satisfy the functor passed to it. See example in Atom or Bond Subset Iteration section.

In the example below, the function CountAtoms loops over the atoms and performs a call-back to the predicate functor pred for each atom. If the predicate returns true, a counter is incremented. The main function passes OEIsOxygen predefined atom predicates to the CountAtoms function that counts the number of oxygen atoms in the molecule. (Please note that this function is already implemented in OEChem TK and called OECount.)

Listing 1: Using functor callbacks

package openeye.docexamples.oechem;

import openeye.oechem.*;

public class Functors {

    private static int CountAtoms(OEMolBase mol, OEUnaryAtomPred pred) {
        int counts = 0;
        for (OEAtomBase atom : mol.GetAtoms())
            if (pred.constCall(atom))
                counts++;
        return counts;
    }

    public static void main(String argv[]) {
        OEGraphMol mol = new OEGraphMol();
        oechem.OESmilesToMol(mol, "c1cc[nH]c1CC2COCNC2");
        System.out.println("Number of oxygen atoms = " + CountAtoms(mol,new OEIsOxygen()));
    }
}

Built-in Functors

There are many useful functors already defined in OEChem TK. These can be used by programmers with little or no understanding of the details of how functors work. A programmer can simply pass them to one of the many OEChem TK functions and methods which take predicates as arguments.

Atom Functors

Access	Functor Name
ring atoms	OEAtomIsInRing
chain atoms	OEAtomIsInChain
atom with specified atom index	OEHasAtomIdx
atom with selected atom index	OEAtomIdxSelected
atom with specified atom name	OEHasAtomName
atoms with specified atom stereo	OEHasAtomStereoSpecified
atoms with specified formal charge	OEHasFormalCharge
atoms with specified number of heavy atom neighbors	OEHasHvyDegree
aromatic atoms	OEIsAromaticAtom
atoms with specific hybridization	OEIsAtomHybridization
chiral atoms	OEIsChiralAtom
atoms with anisotropic B-factor parameters	OEHasAnisou
atoms with specified map index	OEHasMapIdx
atoms representing R-Groups	OEIsRGroup
valid atoms (by OpenEye valence conventions)	OEIsValidAtomValence
valid atoms (by MDL valence conventions)	OEIsValidMDLAtomValence
\(n^{th}\) atom	OENthAtom
atoms that are both terminal and heavy	OEIsTermHeavyAtom
atom membership in a set of atoms	OEIsAtomMember

Listing 2: Using predefined atom functors

package openeye.docexamples.oechem;

import openeye.oechem.*;

public class FunctorsAtom {

    public static void main(String argv[]) {
        OEGraphMol mol = new OEGraphMol();
        oechem.OESmilesToMol(mol,"c1cc[nH]c1CC2COCNC2");
        System.out.println("Number of heavy atoms = " + 
                oechem.OECount(mol, new OEIsHeavy()));
        System.out.println("Number of ring atoms  = " + 
                oechem.OECount(mol, new OEAtomIsInRing()));
    }
}

The output of the preceding program is the following:

Number of heavy atoms = 12
Number of ring atoms  = 11

Atomic Number Functors

Access	Functor Name
atoms with specified atomic number	OEHasAtomicNum
carbon atoms	OEIsCarbon
halogen atoms	OEIsHalogen
heavy atoms	OEIsHeavy
hetero atoms	OEIsHetero
explicit hydrogen atoms	OEIsHydrogen
metal atoms	OEIsMetal
nitrogen atoms	OEIsNitrogen
oxygen atoms	OEIsOxygen
sulfur atoms	OEIsSulfur
phosphorus atoms	OEIsPhosphorus
non-carbon atoms	OEIsPolar
polar hydrogen atoms	OEIsPolarHydrogen

Please note that the following two lines produce the same result.

        System.out.println("Number of oxygen atoms = " + 
                oechem.OECount(mol, new OEHasAtomicNum(OEElemNo.O)));
        System.out.println("Number of oxygen atoms = " + 
                oechem.OECount(mol, new OEIsOxygen()));

Bond Functors

Access	Functor Name
ring bonds	OEBondIsInRing
chain bonds	OEBondIsInChain
bond with specified bond index	OEHasBondIdx
bond with selected bond index	OEBondIdxSelected
bonds with specified bond order	OEHasOrder
rotatable bonds	OEIsRotor
chiral bonds	OEIsChiralBond
bonds with specific bond stereo	OEHasBondStereoSpecified
aromatic bonds	OEIsAromaticBond
bond membership in a set of bonds	OEIsBondMember

Listing 3: Using predefined bond functors

package openeye.docexamples.oechem;

import openeye.oechem.*;

public class FunctorsBond {

    public static void main(String argv[]) {
        OEGraphMol mol = new OEGraphMol();
        oechem.OESmilesToMol(mol,"CC(=O)Nc1c[nH]cc1");

        System.out.println("Number of ring bonds  = " + 
                oechem.OECount(mol, new OEBondIsInRing()));
        System.out.println("Number of rotor bonds = " + 
                oechem.OECount(mol, new OEIsRotor()));
    }
}

The output of the preceding program is the following:

Number of ring bonds  = 5
Number of rotor bonds = 2

Group Functors

Access	Functor Name
groups with a specific atom	OEHasAtomInGroup
groups with a specific bond	OEHasBondInGroup
groups with a specific type	OEHasGroupType
groups that store MDL stereo information	OEIsMDLStereoGroup

Reaction Component Functors

Access	Functor Name
atoms of the catalysts or solvents of a reaction	OEAtomIsInAgent
atoms of the product molecule(s)	OEAtomIsInProduct
atoms of the reactant molecule(s)	OEAtomIsInReactant

Conformer Functors

Access	Functor Name
conformer with specified index	OEHasConfIdx
conformer with selected index	OEConfIdxSelected

Residue Data Functors

Access	Functor Name
atoms with specified residue properties	OEAtomMatchResidue
atoms with specified chain id	OEHasChainID
atoms with specified residue number	OEHasResidueNumber
atoms with an alternate location	OEHasAlternateLocation
atoms with specified fragment number	OEHasFragmentNumber
atoms with specified PDB index	OEHasPDBAtomIndex
alpha carbon	OEIsCAlpha
backbone atom	OEIsBackboneAtom
water	OEIsWater
nucleic acid base	OEIsNucleicAcidBase
nucleic acid sugar	OEIsNucleicAcidSugar
nucleic acid phosphate	OEIsNucleicAcidPhosphate

Composite Functors

Occasionally, one may want to use a logical operator to join two or more functors. The following table shows the composite functors defined in OEChem TK.

Composite Functors

Logical Not	Logical or	Logical and	Description
OENotAtom	OEOrAtom	OEAndAtom	atom composite functors
OENotBond	OEOrBond	OEAndBond	bond composite functors
OENotConf	OEOrConf	OEAndConf	conformation composite functors
OENotGroup	OEOrGroup	OEAndGroup	group composite functors
OENotRoleSet	OEOrRoleSet	OEAndRoleSet	roleset composite functors

Each composite functor takes the appropriate number of predicates as arguments and generates a single unary predicate. The following example demonstrates how to use composite functors to build expressions from OEChem TK’s predefined atom predicates.

Listing 4: Combining predefined atom predicates

package openeye.docexamples.oechem;

import openeye.oechem.*;

public class CompositionFunctorsAtom {

    public static void main(String argv[]) {
        OEGraphMol mol = new OEGraphMol();    
        oechem.OESmilesToMol(mol, "c1cnc(O)cc1CCCBr");
        System.out.println("Number of chain atoms = " + 
                oechem.OECount(mol, new OENotAtom( new OEAtomIsInRing())));
        System.out.println("Number of aromatic nitrogens = " + 
                oechem.OECount(mol, new OEAndAtom(new OEIsNitrogen(),
                        new OEIsAromaticAtom())));
        System.out.println("Number of non-carbons = " +
                oechem.OECount(mol, new OENotAtom(new OEHasAtomicNum(OEElemNo.C))));
        System.out.println("Number of nitrogen and oxygen atoms = " +
                oechem.OECount(mol, new OEOrAtom(new OEHasAtomicNum(OEElemNo.N), 
                        new OEHasAtomicNum(OEElemNo.O))));
    }
}

The OECount function returns the number or objects (in this case atoms) matching the given predicate argument.

The output of the preceding program is the following:

Number of chain atoms = 5
Number of aromatic nitrogens = 1
Number of non-carbons = 3
Number of nitrogen and oxygen atoms = 2

Composite functors can be used similarly to combine predefined bond predicates.

Listing 5: Combining predefined bond predicates

package openeye.docexamples.oechem;

import openeye.oechem.*;

public class CompositionFunctorsBond {

    public static void main(String argv[]) {
        OEGraphMol mol = new OEGraphMol();    
        oechem.OESmilesToMol(mol, "N#CCC1CCNC=C1");
        System.out.println("Number of non-rotatable bonds = " +
                oechem.OECount(mol,new OENotBond(new OEIsRotor())));
        System.out.println("Number of ring double bonds = " +
                oechem.OECount(mol,new OEAndBond(new OEBondIsInRing(),
                        new OEHasOrder(2))));
        System.out.println("Number of double or triple bonds = " +
                oechem.OECount(mol,new OEOrBond(new OEHasOrder(2),
                        new OEHasOrder(3))));
    }
}

The output of the preceding program is the following:

Number of non-rotatable bonds = 8
Number of ring double bonds = 1
Number of double or triple bonds = 2

User Defined Functors

While many predefined functors exist in OEChem TK, it is not difficult to find a situation which calls for a new user-defined functor.

User-defined functor can be written by deriving from either the OEUnaryAtomPred or the OEUnaryBondPred class.

The following example shows a user defined atom functor which returns true for aliphatic nitrogens.

Listing 6: User defined atom predicate

package openeye.docexamples.oechem;

import openeye.oechem.*;

public class UserPredAtom {

    private static class PredAliphaticNitrogen extends OEUnaryAtomPred {
        public boolean constCall(OEAtomBase atom) {
            return atom.IsNitrogen() && ! atom.IsAromatic();
        }
        public OEUnaryAtomBoolFunc CreateCopy() {
            OEUnaryAtomBoolFunc copy = new  PredAliphaticNitrogen();
            copy.swigReleaseOwnership();
            return copy;
        }
    }

    public static void main(String argv[]) {
        OEGraphMol mol = new OEGraphMol();    
        oechem.OESmilesToMol(mol,"c1cc[nH]c1CC2COCNC2");
        System.out.println("Number of aliphatic N atoms = " + 
                oechem.OECount(mol,new PredAliphaticNitrogen()));
    }
}

The output of the preceding program is the following:

Number of aliphatic N atoms = 1

A bond predicate can be similarly defined by deriving from the OEUnaryBondPred class.

Listing 7: User defined bond predicate

package openeye.docexamples.oechem;

import openeye.oechem.*;

public class UserPredBond {

    private static class PredHasDoubleBondO extends OEUnaryAtomPred {
        public boolean constCall(OEAtomBase atom) {
            for (OEBondBase bond : atom.GetBonds()) {
                if (bond.GetOrder() == 2 && bond.GetNbr(atom).IsOxygen())
                    return true;
            }
            return false;
        }
        public  OEUnaryAtomBoolFunc CreateCopy() {
            OEUnaryAtomBoolFunc copy = new PredHasDoubleBondO();
            copy.swigReleaseOwnership();
            return copy;
        }
    }

    private static class PredAmideBond extends OEUnaryBondPred {
        public boolean constCall(OEBondBase bond) {      
            if (bond.GetOrder() != 1)
                return false;      
            OEAtomBase atomB = bond.GetBgn();
            OEAtomBase atomE = bond.GetEnd();    
            OEUnaryAtomBoolFunc pred =  new PredHasDoubleBondO();
            if (atomB.IsCarbon() && atomE.IsNitrogen() && pred. constCall(atomB))
                return true;
            if (atomB.IsNitrogen() && atomE.IsCarbon() && pred. constCall(atomE))
                return true;
            return false;
        }
        public  OEUnaryBondBoolFunc CreateCopy() {
            OEUnaryBondBoolFunc copy = new PredAmideBond();
            copy.swigReleaseOwnership();
            return copy;
        }
    }

    public static void main(String argv[]) {
        OEGraphMol mol = new OEGraphMol();    
        oechem.OESmilesToMol(mol,"CC(=O)Nc1c[nH]cc1");
        System.out.println("Number of amide bonds = " + 
                oechem.OECount(mol,new PredAmideBond()));
    }
}

The output of the preceding program is the following:

Number of amide bonds = 1

One advantage of functors over function pointers is that they can hold state. Since this state is held by the instance of the object it can be thread safe (unlike static-variables inside functions used with function pointers). The state of a functor can be initialized at construction. For instance, OEHasAtomicNum functor takes an argument on construction which defines which atomic number is required for the functor to return true.

Listing 8: User defined atom predicate with state

package openeye.docexamples.oechem;

import openeye.oechem.*;

public class UserPredAtomArg {

    private static class PredAtomicNumList extends OEUnaryAtomPred {
        public PredAtomicNumList(OEUIntArray a)
        {
            alist = new OEUIntArray(a);
        }
        public boolean constCall(OEAtomBase atom) {
            for (int i =0; i < alist.len(); ++i) {
                if (atom.GetAtomicNum() == alist.getItem(i))
                    return true;
            }
            return false;
        }
        public OEUnaryAtomBoolFunc CreateCopy() {
            OEUnaryAtomBoolFunc copy = new PredAtomicNumList(alist);
            copy.swigReleaseOwnership();
            return copy;
        }
        private OEUIntArray alist;
    }

    public static void main(String argv[]) {
        OEGraphMol mol = new OEGraphMol();    
        oechem.OESmilesToMol(mol,"c1cc[nH]c1CC2COCNC2");
        OEUIntArray alist = new OEUIntArray(2);
        alist.setItem(0,OEElemNo.O);
        alist.setItem(1,OEElemNo.N);
        System.out.println("Number of oxygen or nitrogen atoms = " + 
                oechem.OECount(mol, new PredAtomicNumList(alist)));
    }
}

Functor substructure-based matching

The Listing 6 shows an example how to create a user-defined atom predicate. OEChem TK also provides a functor template, called OEMatchFunc, that allows convenient substructure-based atom matching.

In the following example functors are initialized with a SMARTS string. These functors return true only if the atom matches the substructure pattern specified in construction.

Listing 9: Functor substructure-based matching

package openeye.docexamples.oechem;

import openeye.oechem.*;

public class FunctorsOEMatch {

    public static void main(String argv[]) {
        OEGraphMol mol = new OEGraphMol();
        oechem.OESmilesToMol(mol,"C1(Cl)C(N)C(F)OC1C(=O)NCCCN");
        System.out.println("Number of non-amide nitrogen = " +
                oechem.OECount(mol,new OEMatchAtom("[N;!$(NC=O)]")));
        System.out.println("Number of 5-membered ring oxygen = " +
                oechem.OECount(mol,new OEMatchAtom("[O;r5]")));
        System.out.println("Number of carbon attached to halogen = " +
                oechem.OECount(mol,new OEMatchAtom("[#6][Cl,Br,F]")));
    }
}

The output of Listing 9 is the following:

Number of non-amide nitrogen = 2
Number of 5-membered ring oxygen = 1
Number of carbon attached to halogen = 2

Molecule Partitioning

The OESubsetMol function can take any atom predicate as an argument and generate a subset molecule from only atoms for which the specified predicate returns true. In the following example, ring atoms are extracted from a molecule by using the OEAtomIsInRing atom functor.

Listing 10: Ring system extraction

package openeye.docexamples.oechem;

import openeye.oechem.*;

public class FunctorsOESubsetMol {

    public static void main(String argv[]) {
        OEGraphMol mol = new OEGraphMol();
        oechem.OESmilesToMol(mol,"c1cc[nH]c1CC2COCNC2");
        OEGraphMol submol = new OEGraphMol();
        oechem.OESubsetMol(submol,mol,new OEAtomIsInRing(),true);
        System.out.println(oechem.OEMolToSmiles(submol));
    }
}

The output of Listing 10 is the following:

c1cc[nH]c1.C1CNCOC1

In the following example, ring systems are extracted from a molecule by using OEPartPred functor.

Listing 11: Ring system extraction

package openeye.docexamples.oechem;

import openeye.oechem.*;

public class FunctorsOEPartPred {

    public static void main(String argv[]) {
        OEGraphMol mol = new OEGraphMol();
        oechem.OESmilesToMol(mol,"c1cc[nH]c1CC2COCNC2");

        int[] rings = new int[mol.GetMaxAtomIdx()];
        int nrrings = oechem.OEDetermineRingSystems(mol,rings);
        OEPartPredAtom pred = new OEPartPredAtom(rings);
        System.out.println("Number of rings = " + nrrings);
        for (int r = 1; r < nrrings+1; ++r) {
            pred.SelectPart(r);
            OEGraphMol ringmol = new OEGraphMol();
            oechem.OESubsetMol(ringmol,mol,pred,true);
            System.out.println(r + " -> " + oechem.OEMolToSmiles(ringmol));
        }
    }
}

The output of Listing 11 is the following:

Number of rings = 2
1 -> c1cc[nH]c1
2 -> C1CNCOC1