InChI validation¶
The InChI strings returned by OECreateInChI were rigorously tested to ensure
that they were identical to the InChI strings generated by the standalone InChI utility program.
Database |
Size |
Number of failures |
Success Rate |
|---|---|---|---|
eMolecules |
9.1M |
1,350 |
99.97 % |
ChEMBL_23 |
1.7M |
8,255 |
99.52 % |
Many failures are due to the problem that OEChem TK and InChI handle some incorrect bond stereo configurations differently. See example in Difference due atom stereo perception
Additionally there are approximately 7,300 structures in ChEMBL_23 where the InChI, SMILES
and SDF forms for the record are in disagreement resulting in ambiguity for the expected or reference InChI.
Differences due atom stereo perception¶ ![]()
InChI standalone
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)
OECreateInChI
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m1/s1
See example in Difference due atom stereo perception